C17H15N4O2- — CID 135482464
N,1-bis(4-methylphenyl)-5-oxo-2H-triazole-4-carboximidate (PubChem CID 135482464) has the molecular formula C17H15N4O2- and a molecular weight of 307.33 g/mol. Its IUPAC name is N,1-bis(4-methylphenyl)-5-oxo-2H-triazole-4-carboximidate.
| Compound Name | N,1-bis(4-methylphenyl)-5-oxo-2H-triazole-4-carboximidate |
|---|---|
| PubChem CID | 135482464 |
| Molecular Formula | C17H15N4O2- |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | N,1-bis(4-methylphenyl)-5-oxo-2H-triazole-4-carboximidate |
| SMILES | Cc1ccc(/N=C(\[O-])c2n[nH]n(-c3ccc(C)cc3)c2=O)cc1 |
| InChI | InChI=1S/C17H16N4O2/c1-11-3-7-13(8-4-11)18-16(22)15-17(23)21(20-19-15)14-9-5-12(2)6-10-14/h3-10,20H,1-2H3,(H,18,22)/p-1 |
| InChIKey | KSVXVZRLSRIRSS-UHFFFAOYSA-M |
| XLogP | 1.62 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|