C19H20N4O2 — CID 135610465
3-ethyl-N,1-bis(4-methylphenyl)-5-oxo-2H-triazol-3-ium-4-carboximidate (PubChem CID 135610465) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 3-ethyl-N,1-bis(4-methylphenyl)-5-oxo-2H-triazol-3-ium-4-carboximidate.
| Compound Name | 3-ethyl-N,1-bis(4-methylphenyl)-5-oxo-2H-triazol-3-ium-4-carboximidate |
|---|---|
| PubChem CID | 135610465 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 3-ethyl-N,1-bis(4-methylphenyl)-5-oxo-2H-triazol-3-ium-4-carboximidate |
| SMILES | CC[n+]1[nH]n(-c2ccc(C)cc2)c(=O)c1/C([O-])=N/c1ccc(C)cc1 |
| InChI | InChI=1S/C19H20N4O2/c1-4-22-17(18(24)20-15-9-5-13(2)6-10-15)19(25)23(21-22)16-11-7-14(3)8-12-16/h5-12H,4H2,1-3H3,(H-,20,21,24,25) |
| InChIKey | BLQPAOBKEUFYAR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|