C10H10N4NaO2+ — CID 54608700
sodium 1-(4-methylphenyl)-5-oxo-2H-triazole-4-carboxamide (PubChem CID 54608700) has the molecular formula C10H10N4NaO2+ and a molecular weight of 241.21 g/mol. Its IUPAC name is sodium 1-(4-methylphenyl)-5-oxo-2H-triazole-4-carboxamide.
| Compound Name | sodium 1-(4-methylphenyl)-5-oxo-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 54608700 |
| Molecular Formula | C10H10N4NaO2+ |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | sodium 1-(4-methylphenyl)-5-oxo-2H-triazole-4-carboxamide |
| SMILES | Cc1ccc(-n2[nH]nc(C(N)=O)c2=O)cc1.[Na+] |
| InChI | InChI=1S/C10H10N4O2.Na/c1-6-2-4-7(5-3-6)14-10(16)8(9(11)15)12-13-14;/h2-5,13H,1H3,(H2,11,15);/q;+1 |
| InChIKey | UCHQMEFCVZYJIM-UHFFFAOYSA-N |
| XLogP | -3.03 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |