C18H34N4O4 — CID 135802796
tert-butyl (2S)-2-[[(1S)-1-(dimethylcarbamoylamino)-3-methylbutyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 135802796) has the molecular formula C18H34N4O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(1S)-1-(dimethylcarbamoylamino)-3-methylbutyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[(1S)-1-(dimethylcarbamoylamino)-3-methylbutyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 135802796 |
| Molecular Formula | C18H34N4O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | tert-butyl (2S)-2-[[(1S)-1-(dimethylcarbamoylamino)-3-methylbutyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)C[C@@H](NC(=O)[C@@H]1CCCN1C(=O)OC(C)(C)C)NC(=O)N(C)C |
| InChI | InChI=1S/C18H34N4O4/c1-12(2)11-14(20-16(24)21(6)7)19-15(23)13-9-8-10-22(13)17(25)26-18(3,4)5/h12-14H,8-11H2,1-7H3,(H,19,23)(H,20,24)/t13-,14-/m0/s1 |
| InChIKey | ACAUEJRBBCIMMB-KBPBESRZSA-N |
| XLogP | 2.15 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|