C16H12F2N6O4S — CID 135803214
4-cyclopropyl-6-(difluoromethyl)-3-[(5-nitro-1H-pyrazole-3-carbonyl)amino]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 135803214) has the molecular formula C16H12F2N6O4S and a molecular weight of 422.37 g/mol. Its IUPAC name is 4-cyclopropyl-6-(difluoromethyl)-3-[(5-nitro-1H-pyrazole-3-carbonyl)amino]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 4-cyclopropyl-6-(difluoromethyl)-3-[(5-nitro-1H-pyrazole-3-carbonyl)amino]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 135803214 |
| Molecular Formula | C16H12F2N6O4S |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 4-cyclopropyl-6-(difluoromethyl)-3-[(5-nitro-1H-pyrazole-3-carbonyl)amino]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | NC(=O)c1sc2nc(C(F)F)cc(C3CC3)c2c1NC(=O)c1cc([N+](=O)[O-])[nH]n1 |
| InChI | InChI=1S/C16H12F2N6O4S/c17-13(18)7-3-6(5-1-2-5)10-11(12(14(19)25)29-16(10)20-7)21-15(26)8-4-9(23-22-8)24(27)28/h3-5,13H,1-2H2,(H2,19,25)(H,21,26)(H,22,23) |
| InChIKey | GUVIGDQUXYWXHO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 156.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|