C20H20F2N6O4S — CID 19528621
4-cyclopropyl-6-(difluoromethyl)-3-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19528621) has the molecular formula C20H20F2N6O4S and a molecular weight of 478.48 g/mol. Its IUPAC name is 4-cyclopropyl-6-(difluoromethyl)-3-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 4-cyclopropyl-6-(difluoromethyl)-3-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19528621 |
| Molecular Formula | C20H20F2N6O4S |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 4-cyclopropyl-6-(difluoromethyl)-3-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1nn(C(C)C(=O)Nc2c(C(N)=O)sc3nc(C(F)F)cc(C4CC4)c23)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20F2N6O4S/c1-7-15(28(31)32)8(2)27(26-7)9(3)19(30)25-14-13-11(10-4-5-10)6-12(17(21)22)24-20(13)33-16(14)18(23)29/h6,9-10,17H,4-5H2,1-3H3,(H2,23,29)(H,25,30) |
| InChIKey | HVYKDZSBIOJVRN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|