C19H18F2N6O4S — CID 19568164
4-cyclopropyl-6-(difluoromethyl)-3-[3-(5-methyl-4-nitropyrazol-1-yl)propanoylamino]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19568164) has the molecular formula C19H18F2N6O4S and a molecular weight of 464.45 g/mol. Its IUPAC name is 4-cyclopropyl-6-(difluoromethyl)-3-[3-(5-methyl-4-nitropyrazol-1-yl)propanoylamino]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 4-cyclopropyl-6-(difluoromethyl)-3-[3-(5-methyl-4-nitropyrazol-1-yl)propanoylamino]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19568164 |
| Molecular Formula | C19H18F2N6O4S |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 4-cyclopropyl-6-(difluoromethyl)-3-[3-(5-methyl-4-nitropyrazol-1-yl)propanoylamino]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1c([N+](=O)[O-])cnn1CCC(=O)Nc1c(C(N)=O)sc2nc(C(F)F)cc(C3CC3)c12 |
| InChI | InChI=1S/C19H18F2N6O4S/c1-8-12(27(30)31)7-23-26(8)5-4-13(28)25-15-14-10(9-2-3-9)6-11(17(20)21)24-19(14)32-16(15)18(22)29/h6-7,9,17H,2-5H2,1H3,(H2,22,29)(H,25,28) |
| InChIKey | KPZREBRBFZUFBE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|