C19H14BrF3N8O4S — CID 135803494
3-[(4-bromo-5-nitro-1H-pyrazole-3-carbonyl)amino]-4-(1-ethyl-5-methylpyrazol-4-yl)-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 135803494) has the molecular formula C19H14BrF3N8O4S and a molecular weight of 587.34 g/mol. Its IUPAC name is 3-[(4-bromo-5-nitro-1H-pyrazole-3-carbonyl)amino]-4-(1-ethyl-5-methylpyrazol-4-yl)-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-[(4-bromo-5-nitro-1H-pyrazole-3-carbonyl)amino]-4-(1-ethyl-5-methylpyrazol-4-yl)-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 135803494 |
| Molecular Formula | C19H14BrF3N8O4S |
| Molecular Weight | 587.34 g/mol |
| Exact Mass | 586.00 |
| IUPAC Name | 3-[(4-bromo-5-nitro-1H-pyrazole-3-carbonyl)amino]-4-(1-ethyl-5-methylpyrazol-4-yl)-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CCn1ncc(-c2cc(C(F)(F)F)nc3sc(C(N)=O)c(NC(=O)c4n[nH]c([N+](=O)[O-])c4Br)c23)c1C |
| InChI | InChI=1S/C19H14BrF3N8O4S/c1-3-30-6(2)8(5-25-30)7-4-9(19(21,22)23)26-18-10(7)12(14(36-18)15(24)32)27-17(33)13-11(20)16(29-28-13)31(34)35/h4-5H,3H2,1-2H3,(H2,24,32)(H,27,33)(H,28,29) |
| InChIKey | WDAAMWTWJHPBBB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 174.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|