C14H13N6O2+ — CID 135804420
(E)-[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxynaphthalen-1-yl)methylidene]azanium (PubChem CID 135804420) has the molecular formula C14H13N6O2+ and a molecular weight of 297.30 g/mol. Its IUPAC name is (E)-[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxynaphthalen-1-yl)methylidene]azanium.
| Compound Name | (E)-[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxynaphthalen-1-yl)methylidene]azanium |
|---|---|
| PubChem CID | 135804420 |
| Molecular Formula | C14H13N6O2+ |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (E)-[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2-hydroxynaphthalen-1-yl)methylidene]azanium |
| SMILES | NC(=N/[NH+]=C/c1c(O)ccc2ccccc12)c1nonc1N |
| InChI | InChI=1S/C14H12N6O2/c15-13(12-14(16)20-22-19-12)18-17-7-10-9-4-2-1-3-8(9)5-6-11(10)21/h1-7,21H,(H2,15,18)(H2,16,20)/p+1/b17-7+ |
| InChIKey | KDBNCFOWJSTCDU-REZTVBANSA-O |
| XLogP | -0.67 |
| TPSA | 137.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|