C17H10Cl2N3O5- — CID 135809717
4-[(Z)-2-chloro-2-(7-chloro-4-oxo-3H-quinazolin-2-yl)ethenyl]-2-methoxy-6-nitrophenolate (PubChem CID 135809717) has the molecular formula C17H10Cl2N3O5- and a molecular weight of 407.19 g/mol. Its IUPAC name is 4-[(Z)-2-chloro-2-(7-chloro-4-oxo-3H-quinazolin-2-yl)ethenyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(Z)-2-chloro-2-(7-chloro-4-oxo-3H-quinazolin-2-yl)ethenyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 135809717 |
| Molecular Formula | C17H10Cl2N3O5- |
| Molecular Weight | 407.19 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | 4-[(Z)-2-chloro-2-(7-chloro-4-oxo-3H-quinazolin-2-yl)ethenyl]-2-methoxy-6-nitrophenolate |
| SMILES | COc1cc(/C=C(\Cl)c2nc3cc(Cl)ccc3c(=O)[nH]2)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C17H11Cl2N3O5/c1-27-14-6-8(5-13(15(14)23)22(25)26)4-11(19)16-20-12-7-9(18)2-3-10(12)17(24)21-16/h2-7,23H,1H3,(H,20,21,24)/p-1/b11-4- |
| InChIKey | HVAFSFDUXZAWTR-WCIBSUBMSA-M |
| XLogP | 3.30 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.19 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|