C21H24N2O3S — CID 135809910
5-(3,4-dimethylphenyl)-N-[(4-ethoxyphenyl)methyl]-4-methyl-1,1-dioxo-1,2-thiazol-3-imine (PubChem CID 135809910) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-N-[(4-ethoxyphenyl)methyl]-4-methyl-1,1-dioxo-1,2-thiazol-3-imine.
| Compound Name | 5-(3,4-dimethylphenyl)-N-[(4-ethoxyphenyl)methyl]-4-methyl-1,1-dioxo-1,2-thiazol-3-imine |
|---|---|
| PubChem CID | 135809910 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-N-[(4-ethoxyphenyl)methyl]-4-methyl-1,1-dioxo-1,2-thiazol-3-imine |
| SMILES | CCOc1ccc(C/N=C2\NS(=O)(=O)C(c3ccc(C)c(C)c3)=C2C)cc1 |
| InChI | InChI=1S/C21H24N2O3S/c1-5-26-19-10-7-17(8-11-19)13-22-21-16(4)20(27(24,25)23-21)18-9-6-14(2)15(3)12-18/h6-12H,5,13H2,1-4H3,(H,22,23) |
| InChIKey | OJAXBLCIRKWRGB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|