C20H21ClN2O2S — CID 135809932
5-(4-chlorophenyl)-4-methyl-1,1-dioxo-N-(4-phenylbutan-2-yl)-1,2-thiazol-3-imine (PubChem CID 135809932) has the molecular formula C20H21ClN2O2S and a molecular weight of 388.92 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-methyl-1,1-dioxo-N-(4-phenylbutan-2-yl)-1,2-thiazol-3-imine.
| Compound Name | 5-(4-chlorophenyl)-4-methyl-1,1-dioxo-N-(4-phenylbutan-2-yl)-1,2-thiazol-3-imine |
|---|---|
| PubChem CID | 135809932 |
| Molecular Formula | C20H21ClN2O2S |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 5-(4-chlorophenyl)-4-methyl-1,1-dioxo-N-(4-phenylbutan-2-yl)-1,2-thiazol-3-imine |
| SMILES | CC1=C(c2ccc(Cl)cc2)S(=O)(=O)N/C1=N\C(C)CCc1ccccc1 |
| InChI | InChI=1S/C20H21ClN2O2S/c1-14(8-9-16-6-4-3-5-7-16)22-20-15(2)19(26(24,25)23-20)17-10-12-18(21)13-11-17/h3-7,10-14H,8-9H2,1-2H3,(H,22,23) |
| InChIKey | QSYKOOLCXRXIKN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|