C27H19BrClN3O2 — CID 135810325
3-bromo-N-[4-[[5-[(4-chlorophenyl)methylideneamino]-2-hydroxyphenyl]methylideneamino]phenyl]benzamide (PubChem CID 135810325) has the molecular formula C27H19BrClN3O2 and a molecular weight of 532.83 g/mol. Its IUPAC name is 3-bromo-N-[4-[[5-[(4-chlorophenyl)methylideneamino]-2-hydroxyphenyl]methylideneamino]phenyl]benzamide.
| Compound Name | 3-bromo-N-[4-[[5-[(4-chlorophenyl)methylideneamino]-2-hydroxyphenyl]methylideneamino]phenyl]benzamide |
|---|---|
| PubChem CID | 135810325 |
| Molecular Formula | C27H19BrClN3O2 |
| Molecular Weight | 532.83 g/mol |
| Exact Mass | 531.03 |
| IUPAC Name | 3-bromo-N-[4-[[5-[(4-chlorophenyl)methylideneamino]-2-hydroxyphenyl]methylideneamino]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(/N=C/c2cc(/N=C/c3ccc(Cl)cc3)ccc2O)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C27H19BrClN3O2/c28-21-3-1-2-19(14-21)27(34)32-24-10-8-23(9-11-24)31-17-20-15-25(12-13-26(20)33)30-16-18-4-6-22(29)7-5-18/h1-17,33H,(H,32,34)/b30-16+,31-17+ |
| InChIKey | GPRASDVBLDOWCE-RVSCTIAXSA-N |
| XLogP | 7.56 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.83 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|