C25H19ClN4O3 — CID 10874182
3-[[4-[(4-chlorophenyl)methylideneamino]phenyl]carbamoyl]-6,7-dimethylquinoxaline-2-carboxylic acid (PubChem CID 10874182) has the molecular formula C25H19ClN4O3 and a molecular weight of 458.91 g/mol. Its IUPAC name is 3-[[4-[(4-chlorophenyl)methylideneamino]phenyl]carbamoyl]-6,7-dimethylquinoxaline-2-carboxylic acid.
| Compound Name | 3-[[4-[(4-chlorophenyl)methylideneamino]phenyl]carbamoyl]-6,7-dimethylquinoxaline-2-carboxylic acid |
|---|---|
| PubChem CID | 10874182 |
| Molecular Formula | C25H19ClN4O3 |
| Molecular Weight | 458.91 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 3-[[4-[(4-chlorophenyl)methylideneamino]phenyl]carbamoyl]-6,7-dimethylquinoxaline-2-carboxylic acid |
| SMILES | Cc1cc2nc(C(=O)O)c(C(=O)Nc3ccc(/N=C/c4ccc(Cl)cc4)cc3)nc2cc1C |
| InChI | InChI=1S/C25H19ClN4O3/c1-14-11-20-21(12-15(14)2)30-23(25(32)33)22(29-20)24(31)28-19-9-7-18(8-10-19)27-13-16-3-5-17(26)6-4-16/h3-13H,1-2H3,(H,28,31)(H,32,33)/b27-13+ |
| InChIKey | NLBTVBGBDAASIT-UVHMKAGCSA-N |
| XLogP | 5.60 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.91 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|