C23H21N3OS — CID 135813568
4-[C-ethyl-N-(2-methylimino-4-naphthalen-1-yl-1,3-thiazol-3-yl)carbonimidoyl]phenol (PubChem CID 135813568) has the molecular formula C23H21N3OS and a molecular weight of 387.51 g/mol. Its IUPAC name is 4-[C-ethyl-N-(2-methylimino-4-naphthalen-1-yl-1,3-thiazol-3-yl)carbonimidoyl]phenol.
| Compound Name | 4-[C-ethyl-N-(2-methylimino-4-naphthalen-1-yl-1,3-thiazol-3-yl)carbonimidoyl]phenol |
|---|---|
| PubChem CID | 135813568 |
| Molecular Formula | C23H21N3OS |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 4-[C-ethyl-N-(2-methylimino-4-naphthalen-1-yl-1,3-thiazol-3-yl)carbonimidoyl]phenol |
| SMILES | CCC(=Nn1c(-c2cccc3ccccc23)cs/c1=N\C)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H21N3OS/c1-3-21(17-11-13-18(27)14-12-17)25-26-22(15-28-23(26)24-2)20-10-6-8-16-7-4-5-9-19(16)20/h4-15,27H,3H2,1-2H3/b24-23-,25-21? |
| InChIKey | GUSOIUMDQUNZDP-VTIYJDCQSA-N |
| XLogP | 5.27 |
| TPSA | 49.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|