C22H25N3O4S — CID 135840593
4-[C-ethyl-N-[2-methylimino-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-3-yl]carbonimidoyl]phenol (PubChem CID 135840593) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is 4-[C-ethyl-N-[2-methylimino-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-3-yl]carbonimidoyl]phenol.
| Compound Name | 4-[C-ethyl-N-[2-methylimino-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-3-yl]carbonimidoyl]phenol |
|---|---|
| PubChem CID | 135840593 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 4-[C-ethyl-N-[2-methylimino-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-3-yl]carbonimidoyl]phenol |
| SMILES | CCC(=Nn1c(-c2cc(OC)c(OC)c(OC)c2)cs/c1=N\C)c1ccc(O)cc1 |
| InChI | InChI=1S/C22H25N3O4S/c1-6-17(14-7-9-16(26)10-8-14)24-25-18(13-30-22(25)23-2)15-11-19(27-3)21(29-5)20(12-15)28-4/h7-13,26H,6H2,1-5H3/b23-22-,24-17? |
| InChIKey | LPQMCYKZIRPFHC-AMQXAWOUSA-N |
| XLogP | 4.14 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|