C20H16N4O4 — CID 135816322
2-[4-[3-hydroxy-5-imino-4-(4-oxo-3H-quinazolin-2-yl)-2H-pyrrol-1-yl]phenyl]acetic acid (PubChem CID 135816322) has the molecular formula C20H16N4O4 and a molecular weight of 376.37 g/mol. Its IUPAC name is 2-[4-[3-hydroxy-5-imino-4-(4-oxo-3H-quinazolin-2-yl)-2H-pyrrol-1-yl]phenyl]acetic acid.
| Compound Name | 2-[4-[3-hydroxy-5-imino-4-(4-oxo-3H-quinazolin-2-yl)-2H-pyrrol-1-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 135816322 |
| Molecular Formula | C20H16N4O4 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-[4-[3-hydroxy-5-imino-4-(4-oxo-3H-quinazolin-2-yl)-2H-pyrrol-1-yl]phenyl]acetic acid |
| SMILES | [H]/N=C1/C(c2nc3ccccc3c(=O)[nH]2)=C(O)CN1c1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C20H16N4O4/c21-18-17(19-22-14-4-2-1-3-13(14)20(28)23-19)15(25)10-24(18)12-7-5-11(6-8-12)9-16(26)27/h1-8,21,25H,9-10H2,(H,26,27)(H,22,23,28)/b21-18- |
| InChIKey | JJWPZEIVOXWCRU-UZYVYHOESA-N |
| XLogP | 2.32 |
| TPSA | 130.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|