C21H20N4O3 — CID 135816325
2-[3-hydroxy-5-imino-1-[2-(4-methoxyphenyl)ethyl]-2H-pyrrol-4-yl]-3H-quinazolin-4-one (PubChem CID 135816325) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 2-[3-hydroxy-5-imino-1-[2-(4-methoxyphenyl)ethyl]-2H-pyrrol-4-yl]-3H-quinazolin-4-one.
| Compound Name | 2-[3-hydroxy-5-imino-1-[2-(4-methoxyphenyl)ethyl]-2H-pyrrol-4-yl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135816325 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-[3-hydroxy-5-imino-1-[2-(4-methoxyphenyl)ethyl]-2H-pyrrol-4-yl]-3H-quinazolin-4-one |
| SMILES | [H]/N=C1/C(c2nc3ccccc3c(=O)[nH]2)=C(O)CN1CCc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H20N4O3/c1-28-14-8-6-13(7-9-14)10-11-25-12-17(26)18(19(25)22)20-23-16-5-3-2-4-15(16)21(27)24-20/h2-9,22,26H,10-12H2,1H3,(H,23,24,27)/b22-19- |
| InChIKey | QJKSYWGPGFMWRR-QOCHGBHMSA-N |
| XLogP | 2.74 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|