C13H17N3O5S — CID 135817805
(3S)-N-[(E)-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]-1,1-dioxothiolane-3-carboxamide (PubChem CID 135817805) has the molecular formula C13H17N3O5S and a molecular weight of 327.36 g/mol. Its IUPAC name is (3S)-N-[(E)-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | (3S)-N-[(E)-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 135817805 |
| Molecular Formula | C13H17N3O5S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (3S)-N-[(E)-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]-1,1-dioxothiolane-3-carboxamide |
| SMILES | Cc1ncc(CO)c(/C=N/NC(=O)[C@@H]2CCS(=O)(=O)C2)c1O |
| InChI | InChI=1S/C13H17N3O5S/c1-8-12(18)11(10(6-17)4-14-8)5-15-16-13(19)9-2-3-22(20,21)7-9/h4-5,9,17-18H,2-3,6-7H2,1H3,(H,16,19)/b15-5+/t9-/m1/s1 |
| InChIKey | LIIHTVJTFGDGMU-DXLPTXHLSA-N |
| XLogP | -0.53 |
| TPSA | 128.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|