2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid

C7H13N3O5 — CID 135818228

IUPAC2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid
SMILESCC(N)C(=O)O.CC(O)C(=[N+]=[N-])C(=O)O
InChIInChI=1S/C4H6N2O3.C3H7NO2/c1-2(7)3(6-5)4(8)9;1-2(4)3(5)6/h2,7H,1H3,(H,8,9);2H,4H2,1H3,(H,5,6)
InChIKeyVVQDBJFHPDWVFG-UHFFFAOYSA-N
MW219.20 g/mol
LogP-1.46
Rot. Bonds3

About 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid

2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid (PubChem CID 135818228) has the molecular formula C7H13N3O5 and a molecular weight of 219.20 g/mol. Its IUPAC name is 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid.

Molecular Properties

Compound Name2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid
PubChem CID135818228
Molecular FormulaC7H13N3O5
Molecular Weight219.20 g/mol
Exact Mass219.09
IUPAC Name2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid
SMILESCC(N)C(=O)O.CC(O)C(=[N+]=[N-])C(=O)O
InChIInChI=1S/C4H6N2O3.C3H7NO2/c1-2(7)3(6-5)4(8)9;1-2(4)3(5)6/h2,7H,1H3,(H,8,9);2H,4H2,1H3,(H,5,6)
InChIKeyVVQDBJFHPDWVFG-UHFFFAOYSA-N
XLogP-1.46
TPSA157.25 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.20
LogP ≤ 5-1.46
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}

Analyze 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid?
The IUPAC name of 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid (CID 135818228) is 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid.
What is the SMILES notation for 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid?
The canonical SMILES for 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid is CC(N)C(=O)O.CC(O)C(=[N+]=[N-])C(=O)O.
What is the InChIKey of 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid?
The InChIKey is VVQDBJFHPDWVFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O3.C3H7NO2/c1-2(7)3(6-5)4(8)9;1-2(4)3(5)6/h2,7H,1H3,(H,8,9);2H,4H2,1H3,(H,5,6).
What are the key properties of 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid?
2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid has a molecular weight of 219.20 g/mol, XLogP of -1.46, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid is sourced from PubChem (CID 135818228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).