About 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid
2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid (PubChem CID 135818228) has the molecular formula C7H13N3O5
and a molecular weight of 219.20 g/mol. Its IUPAC name is 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid.
Molecular Properties
| Compound Name | 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid |
| PubChem CID | 135818228 |
| Molecular Formula | C7H13N3O5 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid |
| SMILES | CC(N)C(=O)O.CC(O)C(=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C4H6N2O3.C3H7NO2/c1-2(7)3(6-5)4(8)9;1-2(4)3(5)6/h2,7H,1H3,(H,8,9);2H,4H2,1H3,(H,5,6) |
| InChIKey | VVQDBJFHPDWVFG-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 157.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid?
The IUPAC name of 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid (CID 135818228) is 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid.
What is the SMILES notation for 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid?
The canonical SMILES for 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid is CC(N)C(=O)O.CC(O)C(=[N+]=[N-])C(=O)O.
What is the InChIKey of 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid?
The InChIKey is VVQDBJFHPDWVFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O3.C3H7NO2/c1-2(7)3(6-5)4(8)9;1-2(4)3(5)6/h2,7H,1H3,(H,8,9);2H,4H2,1H3,(H,5,6).
What are the key properties of 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid?
2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid has a molecular weight of 219.20 g/mol, XLogP of -1.46, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopropanoic acid;2-diazo-3-hydroxybutanoic acid is sourced from PubChem (CID 135818228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).