C7H11N3O5 — CID 173389746
(2S)-2-amino-3-(2-diazo-3-hydroxybutanoyl)oxypropanoic acid (PubChem CID 173389746) has the molecular formula C7H11N3O5 and a molecular weight of 217.18 g/mol. Its IUPAC name is (2S)-2-amino-3-(2-diazo-3-hydroxybutanoyl)oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-(2-diazo-3-hydroxybutanoyl)oxypropanoic acid |
|---|---|
| PubChem CID | 173389746 |
| Molecular Formula | C7H11N3O5 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | (2S)-2-amino-3-(2-diazo-3-hydroxybutanoyl)oxypropanoic acid |
| SMILES | CC(O)C(=[N+]=[N-])C(=O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H11N3O5/c1-3(11)5(10-9)7(14)15-2-4(8)6(12)13/h3-4,11H,2,8H2,1H3,(H,12,13)/t3?,4-/m0/s1 |
| InChIKey | WAKGSHQRLIGGLB-BKLSDQPFSA-N |
| XLogP | -2.01 |
| TPSA | 146.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|