C7H12N3O5+ — CID 6066225
(E)-1-(2-amino-2-carboxyethoxy)-1,3-dihydroxybut-1-ene-2-diazonium (PubChem CID 6066225) has the molecular formula C7H12N3O5+ and a molecular weight of 218.19 g/mol. Its IUPAC name is (E)-1-(2-amino-2-carboxyethoxy)-1,3-dihydroxybut-1-ene-2-diazonium.
| Compound Name | (E)-1-(2-amino-2-carboxyethoxy)-1,3-dihydroxybut-1-ene-2-diazonium |
|---|---|
| PubChem CID | 6066225 |
| Molecular Formula | C7H12N3O5+ |
| Molecular Weight | 218.19 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (E)-1-(2-amino-2-carboxyethoxy)-1,3-dihydroxybut-1-ene-2-diazonium |
| SMILES | CC(O)/C([N+]#N)=C(/O)OCC(N)C(=O)O |
| InChI | InChI=1S/C7H11N3O5/c1-3(11)5(10-9)7(14)15-2-4(8)6(12)13/h3-4,11H,2,8H2,1H3,(H-,12,13,14)/p+1/b7-5+ |
| InChIKey | HRQMIRCVJPXSJW-FNORWQNLSA-O |
| XLogP | -0.62 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.19 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|