C16H10ClN5O2 — CID 135818479
3-[1-(2-chlorophenyl)-5-oxo-4H-1,2,4-triazol-3-yl]-1H-quinoxalin-2-one (PubChem CID 135818479) has the molecular formula C16H10ClN5O2 and a molecular weight of 339.74 g/mol. Its IUPAC name is 3-[1-(2-chlorophenyl)-5-oxo-4H-1,2,4-triazol-3-yl]-1H-quinoxalin-2-one.
| Compound Name | 3-[1-(2-chlorophenyl)-5-oxo-4H-1,2,4-triazol-3-yl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 135818479 |
| Molecular Formula | C16H10ClN5O2 |
| Molecular Weight | 339.74 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 3-[1-(2-chlorophenyl)-5-oxo-4H-1,2,4-triazol-3-yl]-1H-quinoxalin-2-one |
| SMILES | O=c1[nH]c2ccccc2nc1-c1nn(-c2ccccc2Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C16H10ClN5O2/c17-9-5-1-4-8-12(9)22-16(24)20-14(21-22)13-15(23)19-11-7-3-2-6-10(11)18-13/h1-8H,(H,19,23)(H,20,21,24) |
| InChIKey | FOVRNARLSAEZQP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.74 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |