C11H9N5O — CID 137079359
3-(2-methyl-1,2,4-triazol-3-yl)-1H-quinoxalin-2-one (PubChem CID 137079359) has the molecular formula C11H9N5O and a molecular weight of 227.23 g/mol. Its IUPAC name is 3-(2-methyl-1,2,4-triazol-3-yl)-1H-quinoxalin-2-one.
| Compound Name | 3-(2-methyl-1,2,4-triazol-3-yl)-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 137079359 |
| Molecular Formula | C11H9N5O |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 3-(2-methyl-1,2,4-triazol-3-yl)-1H-quinoxalin-2-one |
| SMILES | Cn1ncnc1-c1nc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C11H9N5O/c1-16-10(12-6-13-16)9-11(17)15-8-5-3-2-4-7(8)14-9/h2-6H,1H3,(H,15,17) |
| InChIKey | AKYHGUMARCUUQS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |