C14H11N7O — CID 135818382
3-(3,6-dimethyl-[1,2,4]triazolo[3,4-f][1,2,4]triazin-8-yl)-1H-quinoxalin-2-one (PubChem CID 135818382) has the molecular formula C14H11N7O and a molecular weight of 293.29 g/mol. Its IUPAC name is 3-(3,6-dimethyl-[1,2,4]triazolo[3,4-f][1,2,4]triazin-8-yl)-1H-quinoxalin-2-one.
| Compound Name | 3-(3,6-dimethyl-[1,2,4]triazolo[3,4-f][1,2,4]triazin-8-yl)-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 135818382 |
| Molecular Formula | C14H11N7O |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 3-(3,6-dimethyl-[1,2,4]triazolo[3,4-f][1,2,4]triazin-8-yl)-1H-quinoxalin-2-one |
| SMILES | Cc1nc(-c2nc3ccccc3[nH]c2=O)c2nnc(C)n2n1 |
| InChI | InChI=1S/C14H11N7O/c1-7-15-11(13-19-18-8(2)21(13)20-7)12-14(22)17-10-6-4-3-5-9(10)16-12/h3-6H,1-2H3,(H,17,22) |
| InChIKey | HGSKYERMYXRCGO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 101.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |