C18H16ClFN4O3S — CID 135818655
(1E)-1-[7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-yl]-1-hydroxyimino-N,N-dimethylmethanesulfonamide (PubChem CID 135818655) has the molecular formula C18H16ClFN4O3S and a molecular weight of 422.87 g/mol. Its IUPAC name is (1E)-1-[7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-yl]-1-hydroxyimino-N,N-dimethylmethanesulfonamide.
| Compound Name | (1E)-1-[7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-yl]-1-hydroxyimino-N,N-dimethylmethanesulfonamide |
|---|---|
| PubChem CID | 135818655 |
| Molecular Formula | C18H16ClFN4O3S |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | (1E)-1-[7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-yl]-1-hydroxyimino-N,N-dimethylmethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)/C(=N/O)C1=Nc2ccc(Cl)cc2C(c2ccccc2F)=NC1 |
| InChI | InChI=1S/C18H16ClFN4O3S/c1-24(2)28(26,27)18(23-25)16-10-21-17(12-5-3-4-6-14(12)20)13-9-11(19)7-8-15(13)22-16/h3-9,25H,10H2,1-2H3/b23-18+ |
| InChIKey | IVCFLIDMOZBQLX-PTGBLXJZSA-N |
| XLogP | 3.08 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|