C16H13ClN6 — CID 135823171
7-(4-chlorophenyl)-2-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-amine (PubChem CID 135823171) has the molecular formula C16H13ClN6 and a molecular weight of 324.78 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-2-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-amine.
| Compound Name | 7-(4-chlorophenyl)-2-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-amine |
|---|---|
| PubChem CID | 135823171 |
| Molecular Formula | C16H13ClN6 |
| Molecular Weight | 324.78 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 7-(4-chlorophenyl)-2-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-amine |
| SMILES | NC1=NC(c2ccc(Cl)cc2)n2nc(-c3ccccc3)nc2N1 |
| InChI | InChI=1S/C16H13ClN6/c17-12-8-6-11(7-9-12)14-20-15(18)21-16-19-13(22-23(14)16)10-4-2-1-3-5-10/h1-9,14H,(H3,18,19,20,21,22) |
| InChIKey | XSZGJGWRECBYLL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.78 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |