C16H12F3N7 — CID 135922409
2-pyridin-4-yl-7-[4-(trifluoromethyl)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-amine (PubChem CID 135922409) has the molecular formula C16H12F3N7 and a molecular weight of 359.32 g/mol. Its IUPAC name is 2-pyridin-4-yl-7-[4-(trifluoromethyl)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-amine.
| Compound Name | 2-pyridin-4-yl-7-[4-(trifluoromethyl)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-amine |
|---|---|
| PubChem CID | 135922409 |
| Molecular Formula | C16H12F3N7 |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 2-pyridin-4-yl-7-[4-(trifluoromethyl)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-amine |
| SMILES | NC1=NC(c2ccc(C(F)(F)F)cc2)n2nc(-c3ccncc3)nc2N1 |
| InChI | InChI=1S/C16H12F3N7/c17-16(18,19)11-3-1-10(2-4-11)13-23-14(20)24-15-22-12(25-26(13)15)9-5-7-21-8-6-9/h1-8,13H,(H3,20,22,23,24,25) |
| InChIKey | FXQRHKDFXLTYDA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |