C15H12FN7 — CID 135922403
7-(2-fluorophenyl)-2-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-amine (PubChem CID 135922403) has the molecular formula C15H12FN7 and a molecular weight of 309.31 g/mol. Its IUPAC name is 7-(2-fluorophenyl)-2-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-amine.
| Compound Name | 7-(2-fluorophenyl)-2-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-amine |
|---|---|
| PubChem CID | 135922403 |
| Molecular Formula | C15H12FN7 |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 7-(2-fluorophenyl)-2-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-amine |
| SMILES | NC1=NC(c2ccccc2F)n2nc(-c3cccnc3)nc2N1 |
| InChI | InChI=1S/C15H12FN7/c16-11-6-2-1-5-10(11)13-20-14(17)21-15-19-12(22-23(13)15)9-4-3-7-18-8-9/h1-8,13H,(H3,17,19,20,21,22) |
| InChIKey | DOOIVPQOJWAIKA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |