C25H30N6O2 — CID 135826937
N-(2,4-dimethylphenyl)-5-methyl-7-(4-pentoxyphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135826937) has the molecular formula C25H30N6O2 and a molecular weight of 446.56 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-5-methyl-7-(4-pentoxyphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-5-methyl-7-(4-pentoxyphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135826937 |
| Molecular Formula | C25H30N6O2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | N-(2,4-dimethylphenyl)-5-methyl-7-(4-pentoxyphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCCOc1ccc(C2C(C(=O)Nc3ccc(C)cc3C)=C(C)Nc3nnnn32)cc1 |
| InChI | InChI=1S/C25H30N6O2/c1-5-6-7-14-33-20-11-9-19(10-12-20)23-22(18(4)26-25-28-29-30-31(23)25)24(32)27-21-13-8-16(2)15-17(21)3/h8-13,15,23H,5-7,14H2,1-4H3,(H,27,32)(H,26,28,30) |
| InChIKey | NDWVPDCSDZRKEM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|