C16H20N4O2S — CID 135828133
N-(3,4-dimethylphenyl)-2-[(2E,5S)-4-oxo-2-(prop-1-en-2-ylhydrazinylidene)-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135828133) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[(2E,5S)-4-oxo-2-(prop-1-en-2-ylhydrazinylidene)-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[(2E,5S)-4-oxo-2-(prop-1-en-2-ylhydrazinylidene)-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135828133 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[(2E,5S)-4-oxo-2-(prop-1-en-2-ylhydrazinylidene)-1,3-thiazolidin-5-yl]acetamide |
| SMILES | C=C(C)N/N=C1\NC(=O)[C@H](CC(=O)Nc2ccc(C)c(C)c2)S1 |
| InChI | InChI=1S/C16H20N4O2S/c1-9(2)19-20-16-18-15(22)13(23-16)8-14(21)17-12-6-5-10(3)11(4)7-12/h5-7,13,19H,1,8H2,2-4H3,(H,17,21)(H,18,20,22)/t13-/m0/s1 |
| InChIKey | CQDFPPHAOLDQRZ-ZDUSSCGKSA-N |
| XLogP | 2.26 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|