C10H16N4O2S — CID 135828139
N-ethyl-2-[(2Z,5S)-4-oxo-2-(prop-1-en-2-ylhydrazinylidene)-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135828139) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is N-ethyl-2-[(2Z,5S)-4-oxo-2-(prop-1-en-2-ylhydrazinylidene)-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-ethyl-2-[(2Z,5S)-4-oxo-2-(prop-1-en-2-ylhydrazinylidene)-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135828139 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-ethyl-2-[(2Z,5S)-4-oxo-2-(prop-1-en-2-ylhydrazinylidene)-1,3-thiazolidin-5-yl]acetamide |
| SMILES | C=C(C)N/N=C1/NC(=O)[C@H](CC(=O)NCC)S1 |
| InChI | InChI=1S/C10H16N4O2S/c1-4-11-8(15)5-7-9(16)12-10(17-7)14-13-6(2)3/h7,13H,2,4-5H2,1,3H3,(H,11,15)(H,12,14,16)/t7-/m0/s1 |
| InChIKey | JVYRQJGKSWOHHW-ZETCQYMHSA-N |
| XLogP | 0.14 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|