C18H25N3 — CID 135830070
(E)-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-1-(7-ethyl-1H-indol-3-yl)methanimine (PubChem CID 135830070) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is (E)-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-1-(7-ethyl-1H-indol-3-yl)methanimine.
| Compound Name | (E)-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-1-(7-ethyl-1H-indol-3-yl)methanimine |
|---|---|
| PubChem CID | 135830070 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | (E)-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-1-(7-ethyl-1H-indol-3-yl)methanimine |
| SMILES | CCc1cccc2c(/C=N/N3[C@@H](C)CCC[C@@H]3C)c[nH]c12 |
| InChI | InChI=1S/C18H25N3/c1-4-15-9-6-10-17-16(11-19-18(15)17)12-20-21-13(2)7-5-8-14(21)3/h6,9-14,19H,4-5,7-8H2,1-3H3/b20-12+/t13-,14-/m0/s1 |
| InChIKey | MZFQANXTRDCXAK-BXNZEIDJSA-N |
| XLogP | 4.33 |
| TPSA | 31.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|