C18H24N8 — CID 135734076
4-N,6-N-diethyl-2-N-[(E)-(7-ethyl-1H-indol-3-yl)methylideneamino]-1,3,5-triazine-2,4,6-triamine (PubChem CID 135734076) has the molecular formula C18H24N8 and a molecular weight of 352.45 g/mol. Its IUPAC name is 4-N,6-N-diethyl-2-N-[(E)-(7-ethyl-1H-indol-3-yl)methylideneamino]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,6-N-diethyl-2-N-[(E)-(7-ethyl-1H-indol-3-yl)methylideneamino]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 135734076 |
| Molecular Formula | C18H24N8 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | 4-N,6-N-diethyl-2-N-[(E)-(7-ethyl-1H-indol-3-yl)methylideneamino]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(NCC)nc(N/N=C/c2c[nH]c3c(CC)cccc23)n1 |
| InChI | InChI=1S/C18H24N8/c1-4-12-8-7-9-14-13(10-21-15(12)14)11-22-26-18-24-16(19-5-2)23-17(25-18)20-6-3/h7-11,21H,4-6H2,1-3H3,(H3,19,20,23,24,25,26)/b22-11+ |
| InChIKey | NWNKHOPURUDPJB-SSDVNMTOSA-N |
| XLogP | 3.22 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|