C14H20N8 — CID 10424878
2-N-[(E)-(2-aminophenyl)methylideneamino]-4-N,6-N-diethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 10424878) has the molecular formula C14H20N8 and a molecular weight of 300.37 g/mol. Its IUPAC name is 2-N-[(E)-(2-aminophenyl)methylideneamino]-4-N,6-N-diethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[(E)-(2-aminophenyl)methylideneamino]-4-N,6-N-diethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 10424878 |
| Molecular Formula | C14H20N8 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-N-[(E)-(2-aminophenyl)methylideneamino]-4-N,6-N-diethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(NCC)nc(N/N=C/c2ccccc2N)n1 |
| InChI | InChI=1S/C14H20N8/c1-3-16-12-19-13(17-4-2)21-14(20-12)22-18-9-10-7-5-6-8-11(10)15/h5-9H,3-4,15H2,1-2H3,(H3,16,17,19,20,21,22)/b18-9+ |
| InChIKey | PRPHXKMBEVQZBE-GIJQJNRQSA-N |
| XLogP | 1.76 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|