C24H20BrNO — CID 135831041
4-bromo-2-[(2S)-2-methyl-1,2,3,4-tetrahydrobenzo[a]phenanthridin-5-yl]phenol (PubChem CID 135831041) has the molecular formula C24H20BrNO and a molecular weight of 418.33 g/mol. Its IUPAC name is 4-bromo-2-[(2S)-2-methyl-1,2,3,4-tetrahydrobenzo[a]phenanthridin-5-yl]phenol.
| Compound Name | 4-bromo-2-[(2S)-2-methyl-1,2,3,4-tetrahydrobenzo[a]phenanthridin-5-yl]phenol |
|---|---|
| PubChem CID | 135831041 |
| Molecular Formula | C24H20BrNO |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 4-bromo-2-[(2S)-2-methyl-1,2,3,4-tetrahydrobenzo[a]phenanthridin-5-yl]phenol |
| SMILES | C[C@H]1CCc2c(-c3cc(Br)ccc3O)nc3ccc4ccccc4c3c2C1 |
| InChI | InChI=1S/C24H20BrNO/c1-14-6-9-18-19(12-14)23-17-5-3-2-4-15(17)7-10-21(23)26-24(18)20-13-16(25)8-11-22(20)27/h2-5,7-8,10-11,13-14,27H,6,9,12H2,1H3/t14-/m0/s1 |
| InChIKey | RENXPLYJQBTTFQ-AWEZNQCLSA-N |
| XLogP | 6.65 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|