C24H21NO2 — CID 1046041
4-[(10S)-10-methyl-8,9,10,11-tetrahydrobenzo[a]acridin-12-yl]benzene-1,2-diol (PubChem CID 1046041) has the molecular formula C24H21NO2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 4-[(10S)-10-methyl-8,9,10,11-tetrahydrobenzo[a]acridin-12-yl]benzene-1,2-diol.
| Compound Name | 4-[(10S)-10-methyl-8,9,10,11-tetrahydrobenzo[a]acridin-12-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 1046041 |
| Molecular Formula | C24H21NO2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 4-[(10S)-10-methyl-8,9,10,11-tetrahydrobenzo[a]acridin-12-yl]benzene-1,2-diol |
| SMILES | C[C@H]1CCc2nc3ccc4ccccc4c3c(-c3ccc(O)c(O)c3)c2C1 |
| InChI | InChI=1S/C24H21NO2/c1-14-6-9-19-18(12-14)23(16-8-11-21(26)22(27)13-16)24-17-5-3-2-4-15(17)7-10-20(24)25-19/h2-5,7-8,10-11,13-14,26-27H,6,9,12H2,1H3/t14-/m0/s1 |
| InChIKey | CVJGESOJVBNSES-AWEZNQCLSA-N |
| XLogP | 5.59 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|