C22H28N2O — CID 7886798
(2R)-N-cycloheptyl-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxamide (PubChem CID 7886798) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is (2R)-N-cycloheptyl-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxamide.
| Compound Name | (2R)-N-cycloheptyl-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxamide |
|---|---|
| PubChem CID | 7886798 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (2R)-N-cycloheptyl-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxamide |
| SMILES | C[C@@H]1CCc2nc3ccccc3c(C(=O)NC3CCCCCC3)c2C1 |
| InChI | InChI=1S/C22H28N2O/c1-15-12-13-20-18(14-15)21(17-10-6-7-11-19(17)24-20)22(25)23-16-8-4-2-3-5-9-16/h6-7,10-11,15-16H,2-5,8-9,12-14H2,1H3,(H,23,25)/t15-/m1/s1 |
| InChIKey | VFQZKTBXWXBIMF-OAHLLOKOSA-N |
| XLogP | 4.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |