C24H29N5O3 — CID 135833599
N-[3-[butan-2-yl(furan-2-ylmethyl)amino]propyl]-2-(4-oxo-5H-pyridazino[4,5-b]indol-3-yl)acetamide (PubChem CID 135833599) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-[3-[butan-2-yl(furan-2-ylmethyl)amino]propyl]-2-(4-oxo-5H-pyridazino[4,5-b]indol-3-yl)acetamide.
| Compound Name | N-[3-[butan-2-yl(furan-2-ylmethyl)amino]propyl]-2-(4-oxo-5H-pyridazino[4,5-b]indol-3-yl)acetamide |
|---|---|
| PubChem CID | 135833599 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | N-[3-[butan-2-yl(furan-2-ylmethyl)amino]propyl]-2-(4-oxo-5H-pyridazino[4,5-b]indol-3-yl)acetamide |
| SMILES | CCC(C)N(CCCNC(=O)Cn1ncc2c([nH]c3ccccc32)c1=O)Cc1ccco1 |
| InChI | InChI=1S/C24H29N5O3/c1-3-17(2)28(15-18-8-6-13-32-18)12-7-11-25-22(30)16-29-24(31)23-20(14-26-29)19-9-4-5-10-21(19)27-23/h4-6,8-10,13-14,17,27H,3,7,11-12,15-16H2,1-2H3,(H,25,30) |
| InChIKey | SJHZLVJHVNYDMI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|