C28H35N5O3 — CID 20912893
N-[3-[cyclopentyl(furan-2-ylmethyl)amino]propyl]-2-(4-oxo-5-propylpyridazino[4,5-b]indol-3-yl)acetamide (PubChem CID 20912893) has the molecular formula C28H35N5O3 and a molecular weight of 489.62 g/mol. Its IUPAC name is N-[3-[cyclopentyl(furan-2-ylmethyl)amino]propyl]-2-(4-oxo-5-propylpyridazino[4,5-b]indol-3-yl)acetamide.
| Compound Name | N-[3-[cyclopentyl(furan-2-ylmethyl)amino]propyl]-2-(4-oxo-5-propylpyridazino[4,5-b]indol-3-yl)acetamide |
|---|---|
| PubChem CID | 20912893 |
| Molecular Formula | C28H35N5O3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | N-[3-[cyclopentyl(furan-2-ylmethyl)amino]propyl]-2-(4-oxo-5-propylpyridazino[4,5-b]indol-3-yl)acetamide |
| SMILES | CCCn1c2ccccc2c2cnn(CC(=O)NCCCN(Cc3ccco3)C3CCCC3)c(=O)c21 |
| InChI | InChI=1S/C28H35N5O3/c1-2-15-32-25-13-6-5-12-23(25)24-18-30-33(28(35)27(24)32)20-26(34)29-14-8-16-31(21-9-3-4-10-21)19-22-11-7-17-36-22/h5-7,11-13,17-18,21H,2-4,8-10,14-16,19-20H2,1H3,(H,29,34) |
| InChIKey | DNENRBBIHMHNAH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|