C19H16N2O2 — CID 135837267
2-[[3-methyl-5-[(E)-2-phenylethenyl]-1,2-oxazol-4-yl]iminomethyl]phenol (PubChem CID 135837267) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[[3-methyl-5-[(E)-2-phenylethenyl]-1,2-oxazol-4-yl]iminomethyl]phenol.
| Compound Name | 2-[[3-methyl-5-[(E)-2-phenylethenyl]-1,2-oxazol-4-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135837267 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-[[3-methyl-5-[(E)-2-phenylethenyl]-1,2-oxazol-4-yl]iminomethyl]phenol |
| SMILES | Cc1noc(/C=C/c2ccccc2)c1/N=C/c1ccccc1O |
| InChI | InChI=1S/C19H16N2O2/c1-14-19(20-13-16-9-5-6-10-17(16)22)18(23-21-14)12-11-15-7-3-2-4-8-15/h2-13,22H,1H3/b12-11+,20-13+ |
| InChIKey | RMGPVPAHNXBJFK-IUTFFREVSA-N |
| XLogP | 4.61 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|