C10H9N5OS — CID 135838383
2-methyl-3-(2H-tetrazol-5-yl)-1,2-benzothiazin-4-ol (PubChem CID 135838383) has the molecular formula C10H9N5OS and a molecular weight of 247.28 g/mol. Its IUPAC name is 2-methyl-3-(2H-tetrazol-5-yl)-1,2-benzothiazin-4-ol.
| Compound Name | 2-methyl-3-(2H-tetrazol-5-yl)-1,2-benzothiazin-4-ol |
|---|---|
| PubChem CID | 135838383 |
| Molecular Formula | C10H9N5OS |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 2-methyl-3-(2H-tetrazol-5-yl)-1,2-benzothiazin-4-ol |
| SMILES | CN1Sc2ccccc2C(O)=C1c1nn[nH]n1 |
| InChI | InChI=1S/C10H9N5OS/c1-15-8(10-11-13-14-12-10)9(16)6-4-2-3-5-7(6)17-15/h2-5,16H,1H3,(H,11,12,13,14) |
| InChIKey | ZZABDMSSLUOLES-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|