C14H13N3O5S — CID 135841752
ethyl 2-[(2E)-2-[(E)-(2,3-dihydroxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 135841752) has the molecular formula C14H13N3O5S and a molecular weight of 335.34 g/mol. Its IUPAC name is ethyl 2-[(2E)-2-[(E)-(2,3-dihydroxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | ethyl 2-[(2E)-2-[(E)-(2,3-dihydroxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 135841752 |
| Molecular Formula | C14H13N3O5S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | ethyl 2-[(2E)-2-[(E)-(2,3-dihydroxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | CCOC(=O)C=C1S/C(=N/N=C/c2cccc(O)c2O)NC1=O |
| InChI | InChI=1S/C14H13N3O5S/c1-2-22-11(19)6-10-13(21)16-14(23-10)17-15-7-8-4-3-5-9(18)12(8)20/h3-7,18,20H,2H2,1H3,(H,16,17,21)/b10-6?,15-7+ |
| InChIKey | WSSNEXFBABJGLV-XIXPUZNTSA-N |
| XLogP | 1.10 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|