C22H31N3O3 — CID 135843643
N-[2-(diethylamino)ethyl]-4-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]benzamide (PubChem CID 135843643) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-4-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135843643 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(/N=C/C2=C(O)CC(C)(C)CC2=O)cc1 |
| InChI | InChI=1S/C22H31N3O3/c1-5-25(6-2)12-11-23-21(28)16-7-9-17(10-8-16)24-15-18-19(26)13-22(3,4)14-20(18)27/h7-10,15,26H,5-6,11-14H2,1-4H3,(H,23,28)/b24-15+ |
| InChIKey | RCAONEGDGLNVRY-BUVRLJJBSA-N |
| XLogP | 3.66 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|