C29H30Cl2N4O4S — CID 135925090
4-[[5-[(2,6-dichlorophenyl)methylsulfonyl]-2-hydroxy-1H-indol-3-yl]methylideneamino]-N-[2-(diethylamino)ethyl]benzamide (PubChem CID 135925090) has the molecular formula C29H30Cl2N4O4S and a molecular weight of 601.56 g/mol. Its IUPAC name is 4-[[5-[(2,6-dichlorophenyl)methylsulfonyl]-2-hydroxy-1H-indol-3-yl]methylideneamino]-N-[2-(diethylamino)ethyl]benzamide.
| Compound Name | 4-[[5-[(2,6-dichlorophenyl)methylsulfonyl]-2-hydroxy-1H-indol-3-yl]methylideneamino]-N-[2-(diethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 135925090 |
| Molecular Formula | C29H30Cl2N4O4S |
| Molecular Weight | 601.56 g/mol |
| Exact Mass | 600.14 |
| IUPAC Name | 4-[[5-[(2,6-dichlorophenyl)methylsulfonyl]-2-hydroxy-1H-indol-3-yl]methylideneamino]-N-[2-(diethylamino)ethyl]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(/N=C/c2c(O)[nH]c3ccc(S(=O)(=O)Cc4c(Cl)cccc4Cl)cc23)cc1 |
| InChI | InChI=1S/C29H30Cl2N4O4S/c1-3-35(4-2)15-14-32-28(36)19-8-10-20(11-9-19)33-17-23-22-16-21(12-13-27(22)34-29(23)37)40(38,39)18-24-25(30)6-5-7-26(24)31/h5-13,16-17,34,37H,3-4,14-15,18H2,1-2H3,(H,32,36)/b33-17+ |
| InChIKey | SMECIHURPIBERK-ATZGPIRCSA-N |
| XLogP | 5.98 |
| TPSA | 114.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|