C25H21Cl2F3N4O — CID 135843733
7-(3,4-dichlorophenyl)-5-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2-(trifluoromethyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135843733) has the molecular formula C25H21Cl2F3N4O and a molecular weight of 521.37 g/mol. Its IUPAC name is 7-(3,4-dichlorophenyl)-5-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2-(trifluoromethyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(3,4-dichlorophenyl)-5-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2-(trifluoromethyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135843733 |
| Molecular Formula | C25H21Cl2F3N4O |
| Molecular Weight | 521.37 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | 7-(3,4-dichlorophenyl)-5-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2-(trifluoromethyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)NC2CCCc3ccccc32)C(c2ccc(Cl)c(Cl)c2)n2nc(C(F)(F)F)cc2N1 |
| InChI | InChI=1S/C25H21Cl2F3N4O/c1-13-22(24(35)32-19-8-4-6-14-5-2-3-7-16(14)19)23(15-9-10-17(26)18(27)11-15)34-21(31-13)12-20(33-34)25(28,29)30/h2-3,5,7,9-12,19,23,31H,4,6,8H2,1H3,(H,32,35) |
| InChIKey | PVUOBQQTLRUBKF-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.37 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |