C32H35N5O4 — CID 135847475
2-(4-tert-butylphenyl)-5-methyl-N-phenyl-7-(2,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135847475) has the molecular formula C32H35N5O4 and a molecular weight of 553.66 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-5-methyl-N-phenyl-7-(2,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-(4-tert-butylphenyl)-5-methyl-N-phenyl-7-(2,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135847475 |
| Molecular Formula | C32H35N5O4 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | 2-(4-tert-butylphenyl)-5-methyl-N-phenyl-7-(2,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cc(OC)c(C2C(C(=O)Nc3ccccc3)=C(C)Nc3nc(-c4ccc(C(C)(C)C)cc4)nn32)cc1OC |
| InChI | InChI=1S/C32H35N5O4/c1-19-27(30(38)34-22-11-9-8-10-12-22)28(23-17-25(40-6)26(41-7)18-24(23)39-5)37-31(33-19)35-29(36-37)20-13-15-21(16-14-20)32(2,3)4/h8-18,28H,1-7H3,(H,34,38)(H,33,35,36) |
| InChIKey | LBVUELZOILRWLV-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |