C20H15N5O — CID 135851748
4-anilino-5-[(E)-[(Z)-benzylidenehydrazinylidene]methyl]-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 135851748) has the molecular formula C20H15N5O and a molecular weight of 341.37 g/mol. Its IUPAC name is 4-anilino-5-[(E)-[(Z)-benzylidenehydrazinylidene]methyl]-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-anilino-5-[(E)-[(Z)-benzylidenehydrazinylidene]methyl]-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135851748 |
| Molecular Formula | C20H15N5O |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-anilino-5-[(E)-[(Z)-benzylidenehydrazinylidene]methyl]-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | N#Cc1c(Nc2ccccc2)c(/C=N/N=C\c2ccccc2)c[nH]c1=O |
| InChI | InChI=1S/C20H15N5O/c21-11-18-19(25-17-9-5-2-6-10-17)16(13-22-20(18)26)14-24-23-12-15-7-3-1-4-8-15/h1-10,12-14H,(H2,22,25,26)/b23-12-,24-14+ |
| InChIKey | IQINVWKZELEQSD-KIAPAELCSA-N |
| XLogP | 3.44 |
| TPSA | 93.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|