C23H19BrN4OS — CID 135853892
5-[(4-bromophenyl)-sulfanylmethyl]-4-[(4-methylphenyl)diazenyl]-2-phenyl-1H-pyrazol-3-one (PubChem CID 135853892) has the molecular formula C23H19BrN4OS and a molecular weight of 479.40 g/mol. Its IUPAC name is 5-[(4-bromophenyl)-sulfanylmethyl]-4-[(4-methylphenyl)diazenyl]-2-phenyl-1H-pyrazol-3-one.
| Compound Name | 5-[(4-bromophenyl)-sulfanylmethyl]-4-[(4-methylphenyl)diazenyl]-2-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135853892 |
| Molecular Formula | C23H19BrN4OS |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 5-[(4-bromophenyl)-sulfanylmethyl]-4-[(4-methylphenyl)diazenyl]-2-phenyl-1H-pyrazol-3-one |
| SMILES | Cc1ccc(/N=N/c2c(C(S)c3ccc(Br)cc3)[nH]n(-c3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C23H19BrN4OS/c1-15-7-13-18(14-8-15)25-26-21-20(22(30)16-9-11-17(24)12-10-16)27-28(23(21)29)19-5-3-2-4-6-19/h2-14,22,27,30H,1H3/b26-25+ |
| InChIKey | FJCQOVDAXGFCRC-OCEACIFDSA-N |
| XLogP | 6.67 |
| TPSA | 62.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|