About N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide
N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide (PubChem CID 135854177) has the molecular formula C16H14Cl2N2O3
and a molecular weight of 353.21 g/mol. Its IUPAC name is N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide.
Molecular Properties
| Compound Name | N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide |
| PubChem CID | 135854177 |
| Molecular Formula | C16H14Cl2N2O3 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide |
| SMILES | O=C(CCc1ccc(O)cc1)N/N=C\c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C16H14Cl2N2O3/c17-12-7-11(16(23)14(18)8-12)9-19-20-15(22)6-3-10-1-4-13(21)5-2-10/h1-2,4-5,7-9,21,23H,3,6H2,(H,20,22)/b19-9- |
| InChIKey | OCBCUXQSEPNPKI-OCKHKDLRSA-N |
| XLogP | 3.49 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide?
The IUPAC name of N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide (CID 135854177) is N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide.
What is the SMILES notation for N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide?
The canonical SMILES for N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide is O=C(CCc1ccc(O)cc1)N/N=C\c1cc(Cl)cc(Cl)c1O.
What is the InChIKey of N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide?
The InChIKey is OCBCUXQSEPNPKI-OCKHKDLRSA-N. The full InChI is InChI=1S/C16H14Cl2N2O3/c17-12-7-11(16(23)14(18)8-12)9-19-20-15(22)6-3-10-1-4-13(21)5-2-10/h1-2,4-5,7-9,21,23H,3,6H2,(H,20,22)/b19-9-.
What are the key properties of N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide?
N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide has a molecular weight of 353.21 g/mol, XLogP of 3.49, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide is sourced from PubChem (CID 135854177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).